C22H24BrClFNO4S — CID 156855887
N-[1-[(2S)-4-bromo-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-2-yl]-2-(oxiran-2-yl)ethyl]-2-methylpropane-2-sulfonamide (PubChem CID 156855887) has the molecular formula C22H24BrClFNO4S and a molecular weight of 532.86 g/mol. Its IUPAC name is N-[1-[(2S)-4-bromo-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-2-yl]-2-(oxiran-2-yl)ethyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[1-[(2S)-4-bromo-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-2-yl]-2-(oxiran-2-yl)ethyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 156855887 |
| Molecular Formula | C22H24BrClFNO4S |
| Molecular Weight | 532.86 g/mol |
| Exact Mass | 531.03 |
| IUPAC Name | N-[1-[(2S)-4-bromo-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-2-yl]-2-(oxiran-2-yl)ethyl]-2-methylpropane-2-sulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)NC(CC1CO1)[C@@]1(c2ccccc2)Cc2c(cc(F)c(Cl)c2Br)O1 |
| InChI | InChI=1S/C22H24BrClFNO4S/c1-21(2,3)31(27,28)26-18(9-14-12-29-14)22(13-7-5-4-6-8-13)11-15-17(30-22)10-16(25)20(24)19(15)23/h4-8,10,14,18,26H,9,11-12H2,1-3H3/t14?,18?,22-/m0/s1 |
| InChIKey | OMVCHOLONQRYQA-LKFRDORASA-N |
| XLogP | 4.95 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.86 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|