C25H26N4O3S2 — CID 166751200
4-[2-oxo-6-[(1-thiophen-2-ylsulfonylpiperidin-2-yl)methylamino]benzo[cd]indol-1-yl]butanenitrile (PubChem CID 166751200) has the molecular formula C25H26N4O3S2 and a molecular weight of 494.64 g/mol. Its IUPAC name is 4-[2-oxo-6-[(1-thiophen-2-ylsulfonylpiperidin-2-yl)methylamino]benzo[cd]indol-1-yl]butanenitrile.
| Compound Name | 4-[2-oxo-6-[(1-thiophen-2-ylsulfonylpiperidin-2-yl)methylamino]benzo[cd]indol-1-yl]butanenitrile |
|---|---|
| PubChem CID | 166751200 |
| Molecular Formula | C25H26N4O3S2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 4-[2-oxo-6-[(1-thiophen-2-ylsulfonylpiperidin-2-yl)methylamino]benzo[cd]indol-1-yl]butanenitrile |
| SMILES | N#CCCCN1C(=O)c2cccc3c(NCC4CCCCN4S(=O)(=O)c4cccs4)ccc1c23 |
| InChI | InChI=1S/C25H26N4O3S2/c26-13-2-4-14-28-22-12-11-21(19-8-5-9-20(24(19)22)25(28)30)27-17-18-7-1-3-15-29(18)34(31,32)23-10-6-16-33-23/h5-6,8-12,16,18,27H,1-4,7,14-15,17H2 |
| InChIKey | FQSUWTNQMHJPFR-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|