C41H35N3 — CID 166780398
N-[(1Z,3Z)-1-[3-[2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-4-pyridinyl]-5-(5-phenyl-2-pyridinyl)phenyl]penta-1,3-dienyl]methanimine (PubChem CID 166780398) has the molecular formula C41H35N3 and a molecular weight of 569.75 g/mol. Its IUPAC name is N-[(1Z,3Z)-1-[3-[2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-4-pyridinyl]-5-(5-phenyl-2-pyridinyl)phenyl]penta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z,3Z)-1-[3-[2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-4-pyridinyl]-5-(5-phenyl-2-pyridinyl)phenyl]penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 166780398 |
| Molecular Formula | C41H35N3 |
| Molecular Weight | 569.75 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | N-[(1Z,3Z)-1-[3-[2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-4-pyridinyl]-5-(5-phenyl-2-pyridinyl)phenyl]penta-1,3-dienyl]methanimine |
| SMILES | C=C/C=C\C=C(/C)c1cc(-c2cc(/C(=C/C=C\C)N=C)cc(-c3ccc(-c4ccccc4)cn3)c2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C41H35N3/c1-5-7-11-16-30(3)40-27-35(28-41(44-40)32-19-14-10-15-20-32)34-24-36(38(42-4)21-8-6-2)26-37(25-34)39-23-22-33(29-43-39)31-17-12-9-13-18-31/h5-29H,1,4H2,2-3H3/b8-6-,11-7-,30-16+,38-21- |
| InChIKey | KKQKVYRHRMVNIL-HOGVAKPCSA-N |
| XLogP | 10.91 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.75 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|