C42H38N4O5 — CID 166787920
5-[3'-(diethylamino)-6'-[ethyl(methoxymethyl)amino]-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]-2-phenylisoindole-1,3-dione (PubChem CID 166787920) has the molecular formula C42H38N4O5 and a molecular weight of 678.79 g/mol. Its IUPAC name is 5-[3'-(diethylamino)-6'-[ethyl(methoxymethyl)amino]-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]-2-phenylisoindole-1,3-dione.
| Compound Name | 5-[3'-(diethylamino)-6'-[ethyl(methoxymethyl)amino]-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]-2-phenylisoindole-1,3-dione |
|---|---|
| PubChem CID | 166787920 |
| Molecular Formula | C42H38N4O5 |
| Molecular Weight | 678.79 g/mol |
| Exact Mass | 678.28 |
| IUPAC Name | 5-[3'-(diethylamino)-6'-[ethyl(methoxymethyl)amino]-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]-2-phenylisoindole-1,3-dione |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)COC)ccc1C21c2ccccc2C(=O)N1c1ccc2c(c1)C(=O)N(c1ccccc1)C2=O |
| InChI | InChI=1S/C42H38N4O5/c1-5-43(6-2)28-18-21-35-37(24-28)51-38-25-29(44(7-3)26-50-4)19-22-36(38)42(35)34-16-12-11-15-32(34)41(49)46(42)30-17-20-31-33(23-30)40(48)45(39(31)47)27-13-9-8-10-14-27/h8-25H,5-7,26H2,1-4H3 |
| InChIKey | ZIYLDTRWGBNMJG-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 82.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.79 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|