C40H17F15N4 — CID 16679823
(10Z,14Z,19Z)-5,5-dimethyl-10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-22,23-dihydro-21H-porphyrin (PubChem CID 16679823) has the molecular formula C40H17F15N4 and a molecular weight of 838.57 g/mol. Its IUPAC name is (10Z,14Z,19Z)-5,5-dimethyl-10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-22,23-dihydro-21H-porphyrin.
| Compound Name | (10Z,14Z,19Z)-5,5-dimethyl-10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-22,23-dihydro-21H-porphyrin |
|---|---|
| PubChem CID | 16679823 |
| Molecular Formula | C40H17F15N4 |
| Molecular Weight | 838.57 g/mol |
| Exact Mass | 838.12 |
| IUPAC Name | (10Z,14Z,19Z)-5,5-dimethyl-10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-22,23-dihydro-21H-porphyrin |
| SMILES | CC1(C)c2ccc([nH]2)/C(c2c(F)c(F)c(F)c(F)c2F)=C2/C=CC(=N2)/C(c2c(F)c(F)c(F)c(F)c2F)=c2/cc/c([nH]2)=C(\c2c(F)c(F)c(F)c(F)c2F)c2ccc1[nH]2 |
| InChI | InChI=1S/C40H17F15N4/c1-40(2)17-9-7-15(58-17)20(23-27(43)33(49)38(54)34(50)28(23)44)13-5-3-11(56-13)19(22-25(41)31(47)37(53)32(48)26(22)42)12-4-6-14(57-12)21(16-8-10-18(40)59-16)24-29(45)35(51)39(55)36(52)30(24)46/h3-10,56,58-59H,1-2H3/b19-11+,20-13+,21-14+ |
| InChIKey | CRWDGOYOAVFQJG-NZCNXQSHSA-N |
| XLogP | 9.31 |
| TPSA | 59.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.57 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|