C26H22ClNO4S — CID 16680228
[(1R)-1-[(2R,3S)-2-methyl-1-(4-methylphenyl)sulfonyl-3-phenylaziridin-2-yl]prop-2-ynyl] 4-chlorobenzoate (PubChem CID 16680228) has the molecular formula C26H22ClNO4S and a molecular weight of 479.99 g/mol. Its IUPAC name is [(1R)-1-[(2R,3S)-2-methyl-1-(4-methylphenyl)sulfonyl-3-phenylaziridin-2-yl]prop-2-ynyl] 4-chlorobenzoate.
| Compound Name | [(1R)-1-[(2R,3S)-2-methyl-1-(4-methylphenyl)sulfonyl-3-phenylaziridin-2-yl]prop-2-ynyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 16680228 |
| Molecular Formula | C26H22ClNO4S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | [(1R)-1-[(2R,3S)-2-methyl-1-(4-methylphenyl)sulfonyl-3-phenylaziridin-2-yl]prop-2-ynyl] 4-chlorobenzoate |
| SMILES | C#C[C@@H](OC(=O)c1ccc(Cl)cc1)[C@@]1(C)[C@H](c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H22ClNO4S/c1-4-23(32-25(29)20-12-14-21(27)15-13-20)26(3)24(19-8-6-5-7-9-19)28(26)33(30,31)22-16-10-18(2)11-17-22/h1,5-17,23-24H,2-3H3/t23-,24+,26+,28?/m1/s1 |
| InChIKey | PEOSMGARAGGAJM-QVMLCMNVSA-N |
| XLogP | 5.01 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|