C24H27NO3 — CID 166807282
2-[(3S)-3-(5,6,7,8,9,10-hexahydrobenzo[8]annulen-4-yloxy)butyl]isoindole-1,3-dione (PubChem CID 166807282) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is 2-[(3S)-3-(5,6,7,8,9,10-hexahydrobenzo[8]annulen-4-yloxy)butyl]isoindole-1,3-dione.
| Compound Name | 2-[(3S)-3-(5,6,7,8,9,10-hexahydrobenzo[8]annulen-4-yloxy)butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166807282 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 2-[(3S)-3-(5,6,7,8,9,10-hexahydrobenzo[8]annulen-4-yloxy)butyl]isoindole-1,3-dione |
| SMILES | C[C@@H](CCN1C(=O)c2ccccc2C1=O)Oc1cccc2c1CCCCCC2 |
| InChI | InChI=1S/C24H27NO3/c1-17(15-16-25-23(26)20-12-6-7-13-21(20)24(25)27)28-22-14-8-10-18-9-4-2-3-5-11-19(18)22/h6-8,10,12-14,17H,2-5,9,11,15-16H2,1H3/t17-/m0/s1 |
| InChIKey | JQGXGBDBQDWJST-KRWDZBQOSA-N |
| XLogP | 4.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|