C15H27N3 — CID 166817727
4-N-methyl-5-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]hex-5-ene-1,4,5-triamine (PubChem CID 166817727) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 4-N-methyl-5-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]hex-5-ene-1,4,5-triamine.
| Compound Name | 4-N-methyl-5-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]hex-5-ene-1,4,5-triamine |
|---|---|
| PubChem CID | 166817727 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 4-N-methyl-5-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]hex-5-ene-1,4,5-triamine |
| SMILES | C=C/C=C(\C=C/C)CNC(=C)C(CCCN)NC |
| InChI | InChI=1S/C15H27N3/c1-5-8-14(9-6-2)12-18-13(3)15(17-4)10-7-11-16/h5-6,8-9,15,17-18H,1,3,7,10-12,16H2,2,4H3/b9-6-,14-8+ |
| InChIKey | SSRWLCOWFUVUSP-UVPTZGENSA-N |
| XLogP | 2.11 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|