C37H39N3O3 — CID 166835810
[3-[5-[4-(dibenzylamino)but-1-en-2-yloxy]-1-(oxan-2-yl)indazol-3-yl]phenyl]methanol (PubChem CID 166835810) has the molecular formula C37H39N3O3 and a molecular weight of 573.74 g/mol. Its IUPAC name is [3-[5-[4-(dibenzylamino)but-1-en-2-yloxy]-1-(oxan-2-yl)indazol-3-yl]phenyl]methanol.
| Compound Name | [3-[5-[4-(dibenzylamino)but-1-en-2-yloxy]-1-(oxan-2-yl)indazol-3-yl]phenyl]methanol |
|---|---|
| PubChem CID | 166835810 |
| Molecular Formula | C37H39N3O3 |
| Molecular Weight | 573.74 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | [3-[5-[4-(dibenzylamino)but-1-en-2-yloxy]-1-(oxan-2-yl)indazol-3-yl]phenyl]methanol |
| SMILES | C=C(CCN(Cc1ccccc1)Cc1ccccc1)Oc1ccc2c(c1)c(-c1cccc(CO)c1)nn2C1CCCCO1 |
| InChI | InChI=1S/C37H39N3O3/c1-28(20-21-39(25-29-11-4-2-5-12-29)26-30-13-6-3-7-14-30)43-33-18-19-35-34(24-33)37(32-16-10-15-31(23-32)27-41)38-40(35)36-17-8-9-22-42-36/h2-7,10-16,18-19,23-24,36,41H,1,8-9,17,20-22,25-27H2 |
| InChIKey | GBJXGMNQXCLRSD-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.74 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|