C21H35N3O2S — CID 166838016
N-(7-amino-1-methylsulfanyl-2-oxoheptan-3-yl)-2-(tert-butylamino)-3-phenylpropanamide (PubChem CID 166838016) has the molecular formula C21H35N3O2S and a molecular weight of 393.60 g/mol. Its IUPAC name is N-(7-amino-1-methylsulfanyl-2-oxoheptan-3-yl)-2-(tert-butylamino)-3-phenylpropanamide.
| Compound Name | N-(7-amino-1-methylsulfanyl-2-oxoheptan-3-yl)-2-(tert-butylamino)-3-phenylpropanamide |
|---|---|
| PubChem CID | 166838016 |
| Molecular Formula | C21H35N3O2S |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | N-(7-amino-1-methylsulfanyl-2-oxoheptan-3-yl)-2-(tert-butylamino)-3-phenylpropanamide |
| SMILES | CSCC(=O)C(CCCCN)NC(=O)C(Cc1ccccc1)NC(C)(C)C |
| InChI | InChI=1S/C21H35N3O2S/c1-21(2,3)24-18(14-16-10-6-5-7-11-16)20(26)23-17(12-8-9-13-22)19(25)15-27-4/h5-7,10-11,17-18,24H,8-9,12-15,22H2,1-4H3,(H,23,26) |
| InChIKey | OZDAFLSUFBYOLB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|