C27H54N3S6Sb — CID 16685245
bis[bis(2-methylpropyl)carbamothioylsulfanyl]stibanyl N,N-bis(2-methylpropyl)carbamodithioate (PubChem CID 16685245) has the molecular formula C27H54N3S6Sb and a molecular weight of 734.91 g/mol. Its IUPAC name is bis[bis(2-methylpropyl)carbamothioylsulfanyl]stibanyl N,N-bis(2-methylpropyl)carbamodithioate.
| Compound Name | bis[bis(2-methylpropyl)carbamothioylsulfanyl]stibanyl N,N-bis(2-methylpropyl)carbamodithioate |
|---|---|
| PubChem CID | 16685245 |
| Molecular Formula | C27H54N3S6Sb |
| Molecular Weight | 734.91 g/mol |
| Exact Mass | 733.17 |
| IUPAC Name | bis[bis(2-methylpropyl)carbamothioylsulfanyl]stibanyl N,N-bis(2-methylpropyl)carbamodithioate |
| SMILES | CC(C)CN(CC(C)C)C(=S)S[Sb](SC(=S)N(CC(C)C)CC(C)C)SC(=S)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/3C9H19NS2.Sb/c3*1-7(2)5-10(9(11)12)6-8(3)4;/h3*7-8H,5-6H2,1-4H3,(H,11,12);/q;;;+3/p-3 |
| InChIKey | YZSWKFQTDSEODD-UHFFFAOYSA-K |
| XLogP | 8.87 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.91 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|