C32H53N2O5+ — CID 166866780
benzyl-[2-[bis(2-hydroxyethyl)amino]ethoxymethyl]-methyl-[2-[2-[4-(2,3,3-trimethylbutan-2-yl)phenoxy]ethoxy]ethyl]azanium (PubChem CID 166866780) has the molecular formula C32H53N2O5+ and a molecular weight of 545.79 g/mol. Its IUPAC name is benzyl-[2-[bis(2-hydroxyethyl)amino]ethoxymethyl]-methyl-[2-[2-[4-(2,3,3-trimethylbutan-2-yl)phenoxy]ethoxy]ethyl]azanium.
| Compound Name | benzyl-[2-[bis(2-hydroxyethyl)amino]ethoxymethyl]-methyl-[2-[2-[4-(2,3,3-trimethylbutan-2-yl)phenoxy]ethoxy]ethyl]azanium |
|---|---|
| PubChem CID | 166866780 |
| Molecular Formula | C32H53N2O5+ |
| Molecular Weight | 545.79 g/mol |
| Exact Mass | 545.39 |
| IUPAC Name | benzyl-[2-[bis(2-hydroxyethyl)amino]ethoxymethyl]-methyl-[2-[2-[4-(2,3,3-trimethylbutan-2-yl)phenoxy]ethoxy]ethyl]azanium |
| SMILES | CC(C)(C)C(C)(C)c1ccc(OCCOCC[N+](C)(COCCN(CCO)CCO)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C32H53N2O5/c1-31(2,3)32(4,5)29-12-14-30(15-13-29)39-25-24-37-23-19-34(6,26-28-10-8-7-9-11-28)27-38-22-18-33(16-20-35)17-21-36/h7-15,35-36H,16-27H2,1-6H3/q+1 |
| InChIKey | RZCOFYJMKYMRMY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.79 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|