About diphenoxylead
diphenoxylead (PubChem CID 16687862) has the molecular formula C12H10O2Pb
and a molecular weight of 393.41 g/mol. Its IUPAC name is diphenoxylead.
Molecular Properties
| Compound Name | diphenoxylead |
| PubChem CID | 16687862 |
| Molecular Formula | C12H10O2Pb |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | diphenoxylead |
| SMILES | c1ccc(O[Pb]Oc2ccccc2)cc1 |
| InChI | InChI=1S/2C6H6O.Pb/c2*7-6-4-2-1-3-5-6;/h2*1-5,7H;/q;;+2/p-2 |
| InChIKey | UEQDDJASYZLJFL-UHFFFAOYSA-L |
| XLogP | 2.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze diphenoxylead with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenoxylead?
The IUPAC name of diphenoxylead (CID 16687862) is diphenoxylead.
What is the SMILES notation for diphenoxylead?
The canonical SMILES for diphenoxylead is c1ccc(O[Pb]Oc2ccccc2)cc1.
What is the InChIKey of diphenoxylead?
The InChIKey is UEQDDJASYZLJFL-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H6O.Pb/c2*7-6-4-2-1-3-5-6;/h2*1-5,7H;/q;;+2/p-2.
What are the key properties of diphenoxylead?
diphenoxylead has a molecular weight of 393.41 g/mol, XLogP of 2.68, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenoxylead is sourced from PubChem (CID 16687862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).