C26H24N2OS — CID 166908524
benzenecarboximidoyl spiro[cyclohexane-1,9'-xanthene]-2'-carboximidothioate (PubChem CID 166908524) has the molecular formula C26H24N2OS and a molecular weight of 412.56 g/mol. Its IUPAC name is benzenecarboximidoyl spiro[cyclohexane-1,9'-xanthene]-2'-carboximidothioate.
| Compound Name | benzenecarboximidoyl spiro[cyclohexane-1,9'-xanthene]-2'-carboximidothioate |
|---|---|
| PubChem CID | 166908524 |
| Molecular Formula | C26H24N2OS |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | benzenecarboximidoyl spiro[cyclohexane-1,9'-xanthene]-2'-carboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])c1ccccc1)c1ccc2c(c1)C1(CCCCC1)c1ccccc1O2 |
| InChI | InChI=1S/C26H24N2OS/c27-24(18-9-3-1-4-10-18)30-25(28)19-13-14-23-21(17-19)26(15-7-2-8-16-26)20-11-5-6-12-22(20)29-23/h1,3-6,9-14,17,27-28H,2,7-8,15-16H2/b27-24+,28-25- |
| InChIKey | ZIVBOPUKIBJGJG-BOQRKYGMSA-N |
| XLogP | 7.13 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|