C16H25N2O2P — CID 166922544
(6Z)-1,3-diethyl-2-phenoxy-4,5,8,9-tetrahydro-1,3,2λ5-diazaphosphonine 2-oxide (PubChem CID 166922544) has the molecular formula C16H25N2O2P and a molecular weight of 308.36 g/mol. Its IUPAC name is (6Z)-1,3-diethyl-2-phenoxy-4,5,8,9-tetrahydro-1,3,2λ5-diazaphosphonine 2-oxide.
| Compound Name | (6Z)-1,3-diethyl-2-phenoxy-4,5,8,9-tetrahydro-1,3,2λ5-diazaphosphonine 2-oxide |
|---|---|
| PubChem CID | 166922544 |
| Molecular Formula | C16H25N2O2P |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | (6Z)-1,3-diethyl-2-phenoxy-4,5,8,9-tetrahydro-1,3,2λ5-diazaphosphonine 2-oxide |
| SMILES | CCN1CC/C=C\CCN(CC)P1(=O)Oc1ccccc1 |
| InChI | InChI=1S/C16H25N2O2P/c1-3-17-14-10-5-6-11-15-18(4-2)21(17,19)20-16-12-8-7-9-13-16/h5-9,12-13H,3-4,10-11,14-15H2,1-2H3/b6-5- |
| InChIKey | HVLJCDANIFYKFA-WAYWQWQTSA-N |
| XLogP | 4.17 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|