C15H23N2O2P — CID 169073830
(6Z)-1,3-diethyl-2-phenoxy-5,8-dihydro-4H-1,3,2λ5-diazaphosphocine 2-oxide (PubChem CID 169073830) has the molecular formula C15H23N2O2P and a molecular weight of 294.33 g/mol. Its IUPAC name is (6Z)-1,3-diethyl-2-phenoxy-5,8-dihydro-4H-1,3,2λ5-diazaphosphocine 2-oxide.
| Compound Name | (6Z)-1,3-diethyl-2-phenoxy-5,8-dihydro-4H-1,3,2λ5-diazaphosphocine 2-oxide |
|---|---|
| PubChem CID | 169073830 |
| Molecular Formula | C15H23N2O2P |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (6Z)-1,3-diethyl-2-phenoxy-5,8-dihydro-4H-1,3,2λ5-diazaphosphocine 2-oxide |
| SMILES | CCN1C/C=C\CCN(CC)P1(=O)Oc1ccccc1 |
| InChI | InChI=1S/C15H23N2O2P/c1-3-16-13-9-6-10-14-17(4-2)20(16,18)19-15-11-7-5-8-12-15/h5-9,11-12H,3-4,10,13-14H2,1-2H3/b9-6- |
| InChIKey | VXOCHRJMXDKCRN-TWGQIWQCSA-N |
| XLogP | 3.78 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|