C9H8Br2 — CID 166937977
(4E,6Z)-1,5-dibromo-3-methylideneocta-4,6-dien-1-yne (PubChem CID 166937977) has the molecular formula C9H8Br2 and a molecular weight of 275.97 g/mol. Its IUPAC name is (4E,6Z)-1,5-dibromo-3-methylideneocta-4,6-dien-1-yne.
| Compound Name | (4E,6Z)-1,5-dibromo-3-methylideneocta-4,6-dien-1-yne |
|---|---|
| PubChem CID | 166937977 |
| Molecular Formula | C9H8Br2 |
| Molecular Weight | 275.97 g/mol |
| Exact Mass | 273.90 |
| IUPAC Name | (4E,6Z)-1,5-dibromo-3-methylideneocta-4,6-dien-1-yne |
| SMILES | C=C(C#CBr)/C=C(Br)\C=C/C |
| InChI | InChI=1S/C9H8Br2/c1-3-4-9(11)7-8(2)5-6-10/h3-4,7H,2H2,1H3/b4-3-,9-7+ |
| InChIKey | BBSFZLBMZLMSGA-GAWLIRPZSA-N |
| XLogP | 3.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.97 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|