C15H19N5O5 — CID 166953565
N-(2-amino-2-oxoethyl)-4-[[[2-[(2-formamidoacetyl)amino]acetyl]amino]methyl]benzamide (PubChem CID 166953565) has the molecular formula C15H19N5O5 and a molecular weight of 349.35 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[[2-[(2-formamidoacetyl)amino]acetyl]amino]methyl]benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[[2-[(2-formamidoacetyl)amino]acetyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 166953565 |
| Molecular Formula | C15H19N5O5 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[[2-[(2-formamidoacetyl)amino]acetyl]amino]methyl]benzamide |
| SMILES | NC(=O)CNC(=O)c1ccc(CNC(=O)CNC(=O)CNC=O)cc1 |
| InChI | InChI=1S/C15H19N5O5/c16-12(22)6-20-15(25)11-3-1-10(2-4-11)5-18-14(24)8-19-13(23)7-17-9-21/h1-4,9H,5-8H2,(H2,16,22)(H,17,21)(H,18,24)(H,19,23)(H,20,25) |
| InChIKey | JBXZOZXJTAAJRC-UHFFFAOYSA-N |
| XLogP | -2.62 |
| TPSA | 159.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|