C19H20N8 — CID 166967953
6-[[(1R,3R,4S)-3-(2-imino-5H-pyrrolo[2,3-b]pyrazine-1-carboximidoyl)-4-methylcyclopentyl]amino]pyridine-3-carbonitrile (PubChem CID 166967953) has the molecular formula C19H20N8 and a molecular weight of 360.43 g/mol. Its IUPAC name is 6-[[(1R,3R,4S)-3-(2-imino-5H-pyrrolo[2,3-b]pyrazine-1-carboximidoyl)-4-methylcyclopentyl]amino]pyridine-3-carbonitrile.
| Compound Name | 6-[[(1R,3R,4S)-3-(2-imino-5H-pyrrolo[2,3-b]pyrazine-1-carboximidoyl)-4-methylcyclopentyl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 166967953 |
| Molecular Formula | C19H20N8 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 6-[[(1R,3R,4S)-3-(2-imino-5H-pyrrolo[2,3-b]pyrazine-1-carboximidoyl)-4-methylcyclopentyl]amino]pyridine-3-carbonitrile |
| SMILES | [H]/N=C(\[C@@H]1C[C@H](Nc2ccc(C#N)cn2)C[C@@H]1C)n1/c(=N/[H])cnc2[nH]ccc21 |
| InChI | InChI=1S/C19H20N8/c1-11-6-13(26-17-3-2-12(8-20)9-24-17)7-14(11)18(22)27-15-4-5-23-19(15)25-10-16(27)21/h2-5,9-11,13-14,21-23H,6-7H2,1H3,(H,24,26)/b21-16+,22-18+/t11-,13+,14+/m0/s1 |
| InChIKey | PPZNOUMCPDXGFP-BAFQNPLGSA-N |
| XLogP | 2.46 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|