C19H21N9 — CID 143911902
5-[[3-ethyl-4-(2-imino-5H-pyrrolo[2,3-b]pyrazine-1-carboximidoyl)cyclopentyl]amino]pyrazine-2-carbonitrile (PubChem CID 143911902) has the molecular formula C19H21N9 and a molecular weight of 375.44 g/mol. Its IUPAC name is 5-[[3-ethyl-4-(2-imino-5H-pyrrolo[2,3-b]pyrazine-1-carboximidoyl)cyclopentyl]amino]pyrazine-2-carbonitrile.
| Compound Name | 5-[[3-ethyl-4-(2-imino-5H-pyrrolo[2,3-b]pyrazine-1-carboximidoyl)cyclopentyl]amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 143911902 |
| Molecular Formula | C19H21N9 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 5-[[3-ethyl-4-(2-imino-5H-pyrrolo[2,3-b]pyrazine-1-carboximidoyl)cyclopentyl]amino]pyrazine-2-carbonitrile |
| SMILES | [H]/N=C(\C1CC(Nc2cnc(C#N)cn2)CC1CC)n1/c(=N/[H])cnc2[nH]ccc21 |
| InChI | InChI=1S/C19H21N9/c1-2-11-5-12(27-17-10-24-13(7-20)8-25-17)6-14(11)18(22)28-15-3-4-23-19(15)26-9-16(28)21/h3-4,8-12,14,21-23H,2,5-6H2,1H3,(H,25,27)/b21-16+,22-18+ |
| InChIKey | GWZLDLQNEYUBCB-HFXUAKQVSA-N |
| XLogP | 2.25 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|