C22H21N5O — CID 58557644
4-[(1R,3R,4S)-3-ethyl-4-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]oxybenzonitrile (PubChem CID 58557644) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is 4-[(1R,3R,4S)-3-ethyl-4-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]oxybenzonitrile.
| Compound Name | 4-[(1R,3R,4S)-3-ethyl-4-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]oxybenzonitrile |
|---|---|
| PubChem CID | 58557644 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 4-[(1R,3R,4S)-3-ethyl-4-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]oxybenzonitrile |
| SMILES | CC[C@@H]1C[C@@H](Oc2ccc(C#N)cc2)C[C@@H]1c1ncc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C22H21N5O/c1-2-15-9-18(28-17-5-3-14(11-23)4-6-17)10-19(15)22-26-13-16-12-25-21-20(27(16)22)7-8-24-21/h3-8,12-13,15,18-19,24H,2,9-10H2,1H3/t15-,18-,19+/m1/s1 |
| InChIKey | KKVPZOZMCXOHCW-LZQZEXGQSA-N |
| XLogP | 4.43 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |