C16H28F3N — CID 166968645
(5E)-7,7,7-trifluoro-6-methyl-N-octan-3-ylhepta-1,5-dien-2-amine (PubChem CID 166968645) has the molecular formula C16H28F3N and a molecular weight of 291.40 g/mol. Its IUPAC name is (5E)-7,7,7-trifluoro-6-methyl-N-octan-3-ylhepta-1,5-dien-2-amine.
| Compound Name | (5E)-7,7,7-trifluoro-6-methyl-N-octan-3-ylhepta-1,5-dien-2-amine |
|---|---|
| PubChem CID | 166968645 |
| Molecular Formula | C16H28F3N |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | (5E)-7,7,7-trifluoro-6-methyl-N-octan-3-ylhepta-1,5-dien-2-amine |
| SMILES | C=C(CC/C=C(\C)C(F)(F)F)NC(CC)CCCCC |
| InChI | InChI=1S/C16H28F3N/c1-5-7-8-12-15(6-2)20-14(4)11-9-10-13(3)16(17,18)19/h10,15,20H,4-9,11-12H2,1-3H3/b13-10+ |
| InChIKey | MWWHFXPRLROXBV-JLHYYAGUSA-N |
| XLogP | 5.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|