C28H31NO4 — CID 166987353
[5-[4-(aminomethyl)benzoyl]oxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] 4-methylbenzoate (PubChem CID 166987353) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is [5-[4-(aminomethyl)benzoyl]oxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] 4-methylbenzoate.
| Compound Name | [5-[4-(aminomethyl)benzoyl]oxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 166987353 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | [5-[4-(aminomethyl)benzoyl]oxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC2C3CC(C2OC(=O)c2ccc(CN)cc2)C2C4CCC(C4)C32)cc1 |
| InChI | InChI=1S/C28H31NO4/c1-15-2-6-17(7-3-15)27(30)32-25-21-13-22(24-20-11-10-19(12-20)23(21)24)26(25)33-28(31)18-8-4-16(14-29)5-9-18/h2-9,19-26H,10-14,29H2,1H3 |
| InChIKey | FBRNNBCLONULRA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|