C9H10F3N — CID 166998242
2-methylidene-N-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]but-3-en-1-imine (PubChem CID 166998242) has the molecular formula C9H10F3N and a molecular weight of 189.18 g/mol. Its IUPAC name is 2-methylidene-N-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]but-3-en-1-imine.
| Compound Name | 2-methylidene-N-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]but-3-en-1-imine |
|---|---|
| PubChem CID | 166998242 |
| Molecular Formula | C9H10F3N |
| Molecular Weight | 189.18 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2-methylidene-N-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]but-3-en-1-imine |
| SMILES | C=CC(=C)/C=N/C=C(\C)C(F)(F)F |
| InChI | InChI=1S/C9H10F3N/c1-4-7(2)5-13-6-8(3)9(10,11)12/h4-6H,1-2H2,3H3/b8-6+,13-5+ |
| InChIKey | CCADUESBWZOBEM-KCNVVUQWSA-N |
| XLogP | 3.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.18 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|