C30H33N5OS — CID 167013928
2-[[3-(4-benzyl-1,4-diazepan-1-yl)phenyl]sulfanylamino]-4-(2,6-dimethylphenyl)-1H-pyrimidin-6-one (PubChem CID 167013928) has the molecular formula C30H33N5OS and a molecular weight of 511.70 g/mol. Its IUPAC name is 2-[[3-(4-benzyl-1,4-diazepan-1-yl)phenyl]sulfanylamino]-4-(2,6-dimethylphenyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[[3-(4-benzyl-1,4-diazepan-1-yl)phenyl]sulfanylamino]-4-(2,6-dimethylphenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 167013928 |
| Molecular Formula | C30H33N5OS |
| Molecular Weight | 511.70 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 2-[[3-(4-benzyl-1,4-diazepan-1-yl)phenyl]sulfanylamino]-4-(2,6-dimethylphenyl)-1H-pyrimidin-6-one |
| SMILES | Cc1cccc(C)c1-c1cc(=O)[nH]c(NSc2cccc(N3CCCN(Cc4ccccc4)CC3)c2)n1 |
| InChI | InChI=1S/C30H33N5OS/c1-22-9-6-10-23(2)29(22)27-20-28(36)32-30(31-27)33-37-26-14-7-13-25(19-26)35-16-8-15-34(17-18-35)21-24-11-4-3-5-12-24/h3-7,9-14,19-20H,8,15-18,21H2,1-2H3,(H2,31,32,33,36) |
| InChIKey | ZFUBHXNRVJEVJC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.70 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|