C16H14N2O3 — CID 167016294
3-(2-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl)piperidine-2,6-dione (PubChem CID 167016294) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 3-(2-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl)piperidine-2,6-dione.
| Compound Name | 3-(2-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 167016294 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-(2-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(C2C(=O)N3CC=Cc4cccc2c43)C(=O)N1 |
| InChI | InChI=1S/C16H14N2O3/c19-12-7-6-11(15(20)17-12)13-10-5-1-3-9-4-2-8-18(14(9)10)16(13)21/h1-5,11,13H,6-8H2,(H,17,19,20) |
| InChIKey | MADCOCAXMJRIKU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|