C18H21NO4 — CID 178063132
3-(4-ethyl-9-hydroxy-5-oxo-6,7,8,9-tetrahydrobenzo[7]annulen-6-yl)piperidine-2,6-dione (PubChem CID 178063132) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-(4-ethyl-9-hydroxy-5-oxo-6,7,8,9-tetrahydrobenzo[7]annulen-6-yl)piperidine-2,6-dione.
| Compound Name | 3-(4-ethyl-9-hydroxy-5-oxo-6,7,8,9-tetrahydrobenzo[7]annulen-6-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 178063132 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 3-(4-ethyl-9-hydroxy-5-oxo-6,7,8,9-tetrahydrobenzo[7]annulen-6-yl)piperidine-2,6-dione |
| SMILES | CCc1cccc2c1C(=O)C(C1CCC(=O)NC1=O)CCC2O |
| InChI | InChI=1S/C18H21NO4/c1-2-10-4-3-5-13-14(20)8-6-11(17(22)16(10)13)12-7-9-15(21)19-18(12)23/h3-5,11-12,14,20H,2,6-9H2,1H3,(H,19,21,23) |
| InChIKey | GUOBJEFRQMSVNH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|