C34H41BrN2O3 — CID 167028343
tert-butyl 4-[4-[(Z)-1-(4-bromo-3-methylphenyl)-5-hydroxy-2-phenylpent-1-enyl]-3-methylphenyl]piperazine-1-carboxylate (PubChem CID 167028343) has the molecular formula C34H41BrN2O3 and a molecular weight of 605.62 g/mol. Its IUPAC name is tert-butyl 4-[4-[(Z)-1-(4-bromo-3-methylphenyl)-5-hydroxy-2-phenylpent-1-enyl]-3-methylphenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(Z)-1-(4-bromo-3-methylphenyl)-5-hydroxy-2-phenylpent-1-enyl]-3-methylphenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 167028343 |
| Molecular Formula | C34H41BrN2O3 |
| Molecular Weight | 605.62 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | tert-butyl 4-[4-[(Z)-1-(4-bromo-3-methylphenyl)-5-hydroxy-2-phenylpent-1-enyl]-3-methylphenyl]piperazine-1-carboxylate |
| SMILES | Cc1cc(/C(=C(\CCCO)c2ccccc2)c2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)cc2C)ccc1Br |
| InChI | InChI=1S/C34H41BrN2O3/c1-24-23-28(36-17-19-37(20-18-36)33(39)40-34(3,4)5)14-15-29(24)32(27-13-16-31(35)25(2)22-27)30(12-9-21-38)26-10-7-6-8-11-26/h6-8,10-11,13-16,22-23,38H,9,12,17-21H2,1-5H3/b32-30- |
| InChIKey | NHIZUZUUYVAOCH-GCUVURNUSA-N |
| XLogP | 7.85 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.62 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|