C31H30F3N5O — CID 167037079
(1R,9R)-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-6-[2-(trifluoromethyl)-1H-indol-7-yl]-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile (PubChem CID 167037079) has the molecular formula C31H30F3N5O and a molecular weight of 545.61 g/mol. Its IUPAC name is (1R,9R)-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-6-[2-(trifluoromethyl)-1H-indol-7-yl]-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile.
| Compound Name | (1R,9R)-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-6-[2-(trifluoromethyl)-1H-indol-7-yl]-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile |
|---|---|
| PubChem CID | 167037079 |
| Molecular Formula | C31H30F3N5O |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | (1R,9R)-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-6-[2-(trifluoromethyl)-1H-indol-7-yl]-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile |
| SMILES | C=CC(=O)N1CC2(CCN(c3nc4c(c(-c5cccc6cc(C(F)(F)F)[nH]c56)c3C#N)C[C@H]3C[C@@H]4C3(C)C)C2)C1 |
| InChI | InChI=1S/C31H30F3N5O/c1-4-24(40)39-15-30(16-39)8-9-38(14-30)28-21(13-35)25(20-11-18-12-22(27(20)37-28)29(18,2)3)19-7-5-6-17-10-23(31(32,33)34)36-26(17)19/h4-7,10,18,22,36H,1,8-9,11-12,14-16H2,2-3H3/t18-,22-/m0/s1 |
| InChIKey | ABIWWUFHFNSBEW-AVRDEDQJSA-N |
| XLogP | 6.03 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|