C6H14N2O4 — CID 167039344
N'-(1,3-dihydroxybutan-2-yl)-2,2-dihydroxyethanimidamide (PubChem CID 167039344) has the molecular formula C6H14N2O4 and a molecular weight of 178.19 g/mol. Its IUPAC name is N'-(1,3-dihydroxybutan-2-yl)-2,2-dihydroxyethanimidamide.
| Compound Name | N'-(1,3-dihydroxybutan-2-yl)-2,2-dihydroxyethanimidamide |
|---|---|
| PubChem CID | 167039344 |
| Molecular Formula | C6H14N2O4 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | N'-(1,3-dihydroxybutan-2-yl)-2,2-dihydroxyethanimidamide |
| SMILES | CC(O)C(CO)/N=C(\N)C(O)O |
| InChI | InChI=1S/C6H14N2O4/c1-3(10)4(2-9)8-5(7)6(11)12/h3-4,6,9-12H,2H2,1H3,(H2,7,8) |
| InChIKey | AIICOPJDULUXQT-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|