C29H39N11O6 — CID 167048577
(2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[[3-(3-azido-3-methylbutoxy)-3-methylbutyl]amino]-5-oxopentanoic acid (PubChem CID 167048577) has the molecular formula C29H39N11O6 and a molecular weight of 637.70 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[[3-(3-azido-3-methylbutoxy)-3-methylbutyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[[3-(3-azido-3-methylbutoxy)-3-methylbutyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 167048577 |
| Molecular Formula | C29H39N11O6 |
| Molecular Weight | 637.70 g/mol |
| Exact Mass | 637.31 |
| IUPAC Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[[3-(3-azido-3-methylbutoxy)-3-methylbutyl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)(CCOC(C)(C)CCNC(=O)CC[C@H](NC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1)C(=O)O)N=[N+]=[N-] |
| InChI | InChI=1S/C29H39N11O6/c1-28(2,39-40-31)12-14-46-29(3,4)11-13-32-21(41)10-9-20(26(44)45)36-24(42)17-5-7-18(8-6-17)33-15-19-16-34-23-22(35-19)25(43)38-27(30)37-23/h5-8,16,20,33H,9-15H2,1-4H3,(H,32,41)(H,36,42)(H,44,45)(H3,30,34,37,38,43)/t20-/m0/s1 |
| InChIKey | UXEHHZYXJOVHKT-FQEVSTJZSA-N |
| XLogP | 2.65 |
| TPSA | 263.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.70 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|