C16H11F2IO10S — CID 167058231
1,1-difluoro-2-[[9-(4-iodophenoxy)carbonyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid (PubChem CID 167058231) has the molecular formula C16H11F2IO10S and a molecular weight of 560.22 g/mol. Its IUPAC name is 1,1-difluoro-2-[[9-(4-iodophenoxy)carbonyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[[9-(4-iodophenoxy)carbonyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 167058231 |
| Molecular Formula | C16H11F2IO10S |
| Molecular Weight | 560.22 g/mol |
| Exact Mass | 559.91 |
| IUPAC Name | 1,1-difluoro-2-[[9-(4-iodophenoxy)carbonyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid |
| SMILES | O=C1OC2C(OC(=O)C(F)(F)S(=O)(=O)O)C3OC2C1C3C(=O)Oc1ccc(I)cc1 |
| InChI | InChI=1S/C16H11F2IO10S/c17-16(18,30(23,24)25)15(22)29-12-10-7(8-9(27-10)11(12)28-14(8)21)13(20)26-6-3-1-5(19)2-4-6/h1-4,7-12H,(H,23,24,25) |
| InChIKey | QGMJOSXMQYEVAB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.22 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|