C20H25N2O7P — CID 167094687
3-phosphonooxypropyl 4-[6-(1-isocyanatopropan-2-yl)quinolin-3-yl]butanoate (PubChem CID 167094687) has the molecular formula C20H25N2O7P and a molecular weight of 436.40 g/mol. Its IUPAC name is 3-phosphonooxypropyl 4-[6-(1-isocyanatopropan-2-yl)quinolin-3-yl]butanoate.
| Compound Name | 3-phosphonooxypropyl 4-[6-(1-isocyanatopropan-2-yl)quinolin-3-yl]butanoate |
|---|---|
| PubChem CID | 167094687 |
| Molecular Formula | C20H25N2O7P |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 3-phosphonooxypropyl 4-[6-(1-isocyanatopropan-2-yl)quinolin-3-yl]butanoate |
| SMILES | CC(CN=C=O)c1ccc2ncc(CCCC(=O)OCCCOP(=O)(O)O)cc2c1 |
| InChI | InChI=1S/C20H25N2O7P/c1-15(12-21-14-23)17-6-7-19-18(11-17)10-16(13-22-19)4-2-5-20(24)28-8-3-9-29-30(25,26)27/h6-7,10-11,13,15H,2-5,8-9,12H2,1H3,(H2,25,26,27) |
| InChIKey | SFXHVXVOHVOGEU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|