C20H26N3O6P — CID 167094682
3-[4-[6-(1-isocyanatopropan-2-yl)quinolin-3-yl]butanoylamino]propyl dihydrogen phosphate (PubChem CID 167094682) has the molecular formula C20H26N3O6P and a molecular weight of 435.42 g/mol. Its IUPAC name is 3-[4-[6-(1-isocyanatopropan-2-yl)quinolin-3-yl]butanoylamino]propyl dihydrogen phosphate.
| Compound Name | 3-[4-[6-(1-isocyanatopropan-2-yl)quinolin-3-yl]butanoylamino]propyl dihydrogen phosphate |
|---|---|
| PubChem CID | 167094682 |
| Molecular Formula | C20H26N3O6P |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 3-[4-[6-(1-isocyanatopropan-2-yl)quinolin-3-yl]butanoylamino]propyl dihydrogen phosphate |
| SMILES | CC(CN=C=O)c1ccc2ncc(CCCC(=O)NCCCOP(=O)(O)O)cc2c1 |
| InChI | InChI=1S/C20H26N3O6P/c1-15(12-21-14-24)17-6-7-19-18(11-17)10-16(13-23-19)4-2-5-20(25)22-8-3-9-29-30(26,27)28/h6-7,10-11,13,15H,2-5,8-9,12H2,1H3,(H,22,25)(H2,26,27,28) |
| InChIKey | RXTWTFCKIMAVEH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 138.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|