C24H27FN2O4 — CID 142136956
N-[3-(6,7-dimethoxyquinolin-4-yl)oxypropyl]-4-(4-fluorophenyl)butanamide (PubChem CID 142136956) has the molecular formula C24H27FN2O4 and a molecular weight of 426.49 g/mol. Its IUPAC name is N-[3-(6,7-dimethoxyquinolin-4-yl)oxypropyl]-4-(4-fluorophenyl)butanamide.
| Compound Name | N-[3-(6,7-dimethoxyquinolin-4-yl)oxypropyl]-4-(4-fluorophenyl)butanamide |
|---|---|
| PubChem CID | 142136956 |
| Molecular Formula | C24H27FN2O4 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | N-[3-(6,7-dimethoxyquinolin-4-yl)oxypropyl]-4-(4-fluorophenyl)butanamide |
| SMILES | COc1cc2nccc(OCCCNC(=O)CCCc3ccc(F)cc3)c2cc1OC |
| InChI | InChI=1S/C24H27FN2O4/c1-29-22-15-19-20(16-23(22)30-2)26-13-11-21(19)31-14-4-12-27-24(28)6-3-5-17-7-9-18(25)10-8-17/h7-11,13,15-16H,3-6,12,14H2,1-2H3,(H,27,28) |
| InChIKey | PKCOCXVTDUPXMF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|