C28H31F3N6O4S — CID 167107104
(E)-3-(butylideneamino)-N-[5-[[1-[4-cyano-3-(trifluoromethyl)phenyl]azetidin-3-yl]sulfamoyl]-2-ethoxybenzenecarboximidoyl]but-2-enamide (PubChem CID 167107104) has the molecular formula C28H31F3N6O4S and a molecular weight of 604.66 g/mol. Its IUPAC name is (E)-3-(butylideneamino)-N-[5-[[1-[4-cyano-3-(trifluoromethyl)phenyl]azetidin-3-yl]sulfamoyl]-2-ethoxybenzenecarboximidoyl]but-2-enamide.
| Compound Name | (E)-3-(butylideneamino)-N-[5-[[1-[4-cyano-3-(trifluoromethyl)phenyl]azetidin-3-yl]sulfamoyl]-2-ethoxybenzenecarboximidoyl]but-2-enamide |
|---|---|
| PubChem CID | 167107104 |
| Molecular Formula | C28H31F3N6O4S |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 604.21 |
| IUPAC Name | (E)-3-(butylideneamino)-N-[5-[[1-[4-cyano-3-(trifluoromethyl)phenyl]azetidin-3-yl]sulfamoyl]-2-ethoxybenzenecarboximidoyl]but-2-enamide |
| SMILES | [H]/N=C(\NC(=O)/C=C(C)/N=C/CCC)c1cc(S(=O)(=O)NC2CN(c3ccc(C#N)c(C(F)(F)F)c3)C2)ccc1OCC |
| InChI | InChI=1S/C28H31F3N6O4S/c1-4-6-11-34-18(3)12-26(38)35-27(33)23-14-22(9-10-25(23)41-5-2)42(39,40)36-20-16-37(17-20)21-8-7-19(15-32)24(13-21)28(29,30)31/h7-14,20,36H,4-6,16-17H2,1-3H3,(H2,33,35,38)/b18-12+,34-11+ |
| InChIKey | AAYWXLMQSMSCEJ-GRCDEDMWSA-N |
| XLogP | 4.36 |
| TPSA | 147.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|