C17H19I2NO3S — CID 167118198
O-[3-[methyl-(2-oxochromen-4-yl)amino]propyl] 2,3-diiodo-2-methylpropanethioate (PubChem CID 167118198) has the molecular formula C17H19I2NO3S and a molecular weight of 571.22 g/mol. Its IUPAC name is O-[3-[methyl-(2-oxochromen-4-yl)amino]propyl] 2,3-diiodo-2-methylpropanethioate.
| Compound Name | O-[3-[methyl-(2-oxochromen-4-yl)amino]propyl] 2,3-diiodo-2-methylpropanethioate |
|---|---|
| PubChem CID | 167118198 |
| Molecular Formula | C17H19I2NO3S |
| Molecular Weight | 571.22 g/mol |
| Exact Mass | 570.92 |
| IUPAC Name | O-[3-[methyl-(2-oxochromen-4-yl)amino]propyl] 2,3-diiodo-2-methylpropanethioate |
| SMILES | CN(CCCOC(=S)C(C)(I)CI)c1cc(=O)oc2ccccc12 |
| InChI | InChI=1S/C17H19I2NO3S/c1-17(19,11-18)16(24)22-9-5-8-20(2)13-10-15(21)23-14-7-4-3-6-12(13)14/h3-4,6-7,10H,5,8-9,11H2,1-2H3 |
| InChIKey | FTEWMPZOOUFDFY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.22 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|