C13H15N2O6PS — CID 167274546
2-[[methyl-(2-oxochromen-4-yl)carbamothioyl]amino]ethyl dihydrogen phosphate (PubChem CID 167274546) has the molecular formula C13H15N2O6PS and a molecular weight of 358.31 g/mol. Its IUPAC name is 2-[[methyl-(2-oxochromen-4-yl)carbamothioyl]amino]ethyl dihydrogen phosphate.
| Compound Name | 2-[[methyl-(2-oxochromen-4-yl)carbamothioyl]amino]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 167274546 |
| Molecular Formula | C13H15N2O6PS |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2-[[methyl-(2-oxochromen-4-yl)carbamothioyl]amino]ethyl dihydrogen phosphate |
| SMILES | CN(C(=S)NCCOP(=O)(O)O)c1cc(=O)oc2ccccc12 |
| InChI | InChI=1S/C13H15N2O6PS/c1-15(13(23)14-6-7-20-22(17,18)19)10-8-12(16)21-11-5-3-2-4-9(10)11/h2-5,8H,6-7H2,1H3,(H,14,23)(H2,17,18,19) |
| InChIKey | YLXZMJWINHMPPC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|