C26H33N2O7P — CID 127026092
methyl 2-[[2-[(6-tert-butyl-2-oxochromen-4-yl)-methylamino]ethoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 127026092) has the molecular formula C26H33N2O7P and a molecular weight of 516.53 g/mol. Its IUPAC name is methyl 2-[[2-[(6-tert-butyl-2-oxochromen-4-yl)-methylamino]ethoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl 2-[[2-[(6-tert-butyl-2-oxochromen-4-yl)-methylamino]ethoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 127026092 |
| Molecular Formula | C26H33N2O7P |
| Molecular Weight | 516.53 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | methyl 2-[[2-[(6-tert-butyl-2-oxochromen-4-yl)-methylamino]ethoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)C(C)NP(=O)(OCCN(C)c1cc(=O)oc2ccc(C(C)(C)C)cc12)Oc1ccccc1 |
| InChI | InChI=1S/C26H33N2O7P/c1-18(25(30)32-6)27-36(31,35-20-10-8-7-9-11-20)33-15-14-28(5)22-17-24(29)34-23-13-12-19(16-21(22)23)26(2,3)4/h7-13,16-18H,14-15H2,1-6H3,(H,27,31) |
| InChIKey | USKWWESXNKLGES-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|