C29H31N2O7P — CID 127027361
methyl 2-[[2-[methyl-(6-methyl-2-oxochromen-4-yl)amino]ethoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate (PubChem CID 127027361) has the molecular formula C29H31N2O7P and a molecular weight of 550.55 g/mol. Its IUPAC name is methyl 2-[[2-[methyl-(6-methyl-2-oxochromen-4-yl)amino]ethoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate.
| Compound Name | methyl 2-[[2-[methyl-(6-methyl-2-oxochromen-4-yl)amino]ethoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 127027361 |
| Molecular Formula | C29H31N2O7P |
| Molecular Weight | 550.55 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | methyl 2-[[2-[methyl-(6-methyl-2-oxochromen-4-yl)amino]ethoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NP(=O)(OCCN(C)c1cc(=O)oc2ccc(C)cc12)Oc1ccccc1 |
| InChI | InChI=1S/C29H31N2O7P/c1-21-14-15-27-24(18-21)26(20-28(32)37-27)31(2)16-17-36-39(34,38-23-12-8-5-9-13-23)30-25(29(33)35-3)19-22-10-6-4-7-11-22/h4-15,18,20,25H,16-17,19H2,1-3H3,(H,30,34) |
| InChIKey | LQEHCQUNISGSML-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|