C17H16F3IN4O — CID 167121267
3-fluoro-N-[1-(2-fluoroethyl)azetidin-3-yl]-5-(2-fluoro-4-iodoanilino)pyridine-4-carboxamide (PubChem CID 167121267) has the molecular formula C17H16F3IN4O and a molecular weight of 476.24 g/mol. Its IUPAC name is 3-fluoro-N-[1-(2-fluoroethyl)azetidin-3-yl]-5-(2-fluoro-4-iodoanilino)pyridine-4-carboxamide.
| Compound Name | 3-fluoro-N-[1-(2-fluoroethyl)azetidin-3-yl]-5-(2-fluoro-4-iodoanilino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 167121267 |
| Molecular Formula | C17H16F3IN4O |
| Molecular Weight | 476.24 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | 3-fluoro-N-[1-(2-fluoroethyl)azetidin-3-yl]-5-(2-fluoro-4-iodoanilino)pyridine-4-carboxamide |
| SMILES | O=C(NC1CN(CCF)C1)c1c(F)cncc1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C17H16F3IN4O/c18-3-4-25-8-11(9-25)23-17(26)16-13(20)6-22-7-15(16)24-14-2-1-10(21)5-12(14)19/h1-2,5-7,11,24H,3-4,8-9H2,(H,23,26) |
| InChIKey | GPGGRZRTYFMNPM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|