C18H18F2IN3O3 — CID 44819281
N-[(1R,2S,3R)-2,3-dihydroxycyclohexyl]-3-fluoro-5-(2-fluoro-4-iodoanilino)pyridine-4-carboxamide (PubChem CID 44819281) has the molecular formula C18H18F2IN3O3 and a molecular weight of 489.26 g/mol. Its IUPAC name is N-[(1R,2S,3R)-2,3-dihydroxycyclohexyl]-3-fluoro-5-(2-fluoro-4-iodoanilino)pyridine-4-carboxamide.
| Compound Name | N-[(1R,2S,3R)-2,3-dihydroxycyclohexyl]-3-fluoro-5-(2-fluoro-4-iodoanilino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 44819281 |
| Molecular Formula | C18H18F2IN3O3 |
| Molecular Weight | 489.26 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | N-[(1R,2S,3R)-2,3-dihydroxycyclohexyl]-3-fluoro-5-(2-fluoro-4-iodoanilino)pyridine-4-carboxamide |
| SMILES | O=C(N[C@@H]1CCC[C@@H](O)[C@H]1O)c1c(F)cncc1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C18H18F2IN3O3/c19-10-6-9(21)4-5-12(10)23-14-8-22-7-11(20)16(14)18(27)24-13-2-1-3-15(25)17(13)26/h4-8,13,15,17,23,25-26H,1-3H2,(H,24,27)/t13-,15-,17+/m1/s1 |
| InChIKey | XMBPJUOISPMXOE-UNEWFSDZSA-N |
| XLogP | 2.71 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|