C18H18F2IN3O3 — CID 67081329
(3-amino-2-hydroxycyclohexyl) 3-fluoro-5-(2-fluoro-4-iodoanilino)pyridine-4-carboxylate (PubChem CID 67081329) has the molecular formula C18H18F2IN3O3 and a molecular weight of 489.26 g/mol. Its IUPAC name is (3-amino-2-hydroxycyclohexyl) 3-fluoro-5-(2-fluoro-4-iodoanilino)pyridine-4-carboxylate.
| Compound Name | (3-amino-2-hydroxycyclohexyl) 3-fluoro-5-(2-fluoro-4-iodoanilino)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 67081329 |
| Molecular Formula | C18H18F2IN3O3 |
| Molecular Weight | 489.26 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | (3-amino-2-hydroxycyclohexyl) 3-fluoro-5-(2-fluoro-4-iodoanilino)pyridine-4-carboxylate |
| SMILES | NC1CCCC(OC(=O)c2c(F)cncc2Nc2ccc(I)cc2F)C1O |
| InChI | InChI=1S/C18H18F2IN3O3/c19-10-6-9(21)4-5-13(10)24-14-8-23-7-11(20)16(14)18(26)27-15-3-1-2-12(22)17(15)25/h4-8,12,15,17,24-25H,1-3,22H2 |
| InChIKey | FRGLNTCTMBDEDA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|