C46H91NO6 — CID 167145022
6-[(7-formyl-8-heptadecan-9-yloxyoctyl)-(4-hydroxybutyl)amino]hexyl nonyl carbonate (PubChem CID 167145022) has the molecular formula C46H91NO6 and a molecular weight of 754.23 g/mol. Its IUPAC name is 6-[(7-formyl-8-heptadecan-9-yloxyoctyl)-(4-hydroxybutyl)amino]hexyl nonyl carbonate.
| Compound Name | 6-[(7-formyl-8-heptadecan-9-yloxyoctyl)-(4-hydroxybutyl)amino]hexyl nonyl carbonate |
|---|---|
| PubChem CID | 167145022 |
| Molecular Formula | C46H91NO6 |
| Molecular Weight | 754.23 g/mol |
| Exact Mass | 753.68 |
| IUPAC Name | 6-[(7-formyl-8-heptadecan-9-yloxyoctyl)-(4-hydroxybutyl)amino]hexyl nonyl carbonate |
| SMILES | CCCCCCCCCOC(=O)OCCCCCCN(CCCCO)CCCCCCC(C=O)COC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C46H91NO6/c1-4-7-10-13-16-22-31-40-51-46(50)52-41-32-23-21-28-37-47(38-29-30-39-48)36-27-20-19-24-33-44(42-49)43-53-45(34-25-17-14-11-8-5-2)35-26-18-15-12-9-6-3/h42,44-45,48H,4-41,43H2,1-3H3 |
| InChIKey | AUWNWVUDXCZQTM-UHFFFAOYSA-N |
| XLogP | 13.18 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.23 |
| LogP ≤ 5 | 13.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|