C27H30N4O3 — CID 167146550
3-[[4-[4-(methoxyamino)phenyl]piperazin-1-yl]methyl]-N-phenacylbenzamide (PubChem CID 167146550) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is 3-[[4-[4-(methoxyamino)phenyl]piperazin-1-yl]methyl]-N-phenacylbenzamide.
| Compound Name | 3-[[4-[4-(methoxyamino)phenyl]piperazin-1-yl]methyl]-N-phenacylbenzamide |
|---|---|
| PubChem CID | 167146550 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 3-[[4-[4-(methoxyamino)phenyl]piperazin-1-yl]methyl]-N-phenacylbenzamide |
| SMILES | CONc1ccc(N2CCN(Cc3cccc(C(=O)NCC(=O)c4ccccc4)c3)CC2)cc1 |
| InChI | InChI=1S/C27H30N4O3/c1-34-29-24-10-12-25(13-11-24)31-16-14-30(15-17-31)20-21-6-5-9-23(18-21)27(33)28-19-26(32)22-7-3-2-4-8-22/h2-13,18,29H,14-17,19-20H2,1H3,(H,28,33) |
| InChIKey | QSFFVMQEVGFFIN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|