C44H78N8O14 — CID 167159507
5-[[8-(4-carboxybutanoylamino)-3,6,10,13-tetrakis[(2-methylpropan-2-yl)oxycarbonyl]-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosan-1-yl]amino]-5-oxopentanoic acid (PubChem CID 167159507) has the molecular formula C44H78N8O14 and a molecular weight of 943.15 g/mol. Its IUPAC name is 5-[[8-(4-carboxybutanoylamino)-3,6,10,13-tetrakis[(2-methylpropan-2-yl)oxycarbonyl]-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosan-1-yl]amino]-5-oxopentanoic acid.
| Compound Name | 5-[[8-(4-carboxybutanoylamino)-3,6,10,13-tetrakis[(2-methylpropan-2-yl)oxycarbonyl]-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosan-1-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 167159507 |
| Molecular Formula | C44H78N8O14 |
| Molecular Weight | 943.15 g/mol |
| Exact Mass | 942.56 |
| IUPAC Name | 5-[[8-(4-carboxybutanoylamino)-3,6,10,13-tetrakis[(2-methylpropan-2-yl)oxycarbonyl]-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosan-1-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OC(C)(C)C)CC2(NC(=O)CCCC(=O)O)CNCCNCC(NC(=O)CCCC(=O)O)(C1)CN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C44H78N8O14/c1-39(2,3)63-35(59)49-21-22-50(36(60)64-40(4,5)6)29-44(48-32(54)16-14-18-34(57)58)26-46-20-19-45-25-43(27-49,47-31(53)15-13-17-33(55)56)28-51(37(61)65-41(7,8)9)23-24-52(30-44)38(62)66-42(10,11)12/h45-46H,13-30H2,1-12H3,(H,47,53)(H,48,54)(H,55,56)(H,57,58) |
| InChIKey | MJAKMUJWZZFNCL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 275.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.15 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|