C45H83N7O14 — CID 135394621
tert-butyl hydrogen carbonate;5-[[8-methyl-3,6,10,13-tetrakis[(2-methylpropan-2-yl)oxycarbonyl]-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosan-1-yl]amino]-5-oxopentanoic acid (PubChem CID 135394621) has the molecular formula C45H83N7O14 and a molecular weight of 946.19 g/mol. Its IUPAC name is tert-butyl hydrogen carbonate;5-[[8-methyl-3,6,10,13-tetrakis[(2-methylpropan-2-yl)oxycarbonyl]-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosan-1-yl]amino]-5-oxopentanoic acid.
| Compound Name | tert-butyl hydrogen carbonate;5-[[8-methyl-3,6,10,13-tetrakis[(2-methylpropan-2-yl)oxycarbonyl]-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosan-1-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 135394621 |
| Molecular Formula | C45H83N7O14 |
| Molecular Weight | 946.19 g/mol |
| Exact Mass | 945.60 |
| IUPAC Name | tert-butyl hydrogen carbonate;5-[[8-methyl-3,6,10,13-tetrakis[(2-methylpropan-2-yl)oxycarbonyl]-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosan-1-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)(C)OC(=O)O.CC12CNCCNCC(NC(=O)CCCC(=O)O)(CN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)C1)CN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C40H73N7O11.C5H10O3/c1-35(2,3)55-31(51)44-19-21-46(33(53)57-37(7,8)9)27-40(43-29(48)15-14-16-30(49)50)24-42-18-17-41-23-39(13,25-44)26-45(32(52)56-36(4,5)6)20-22-47(28-40)34(54)58-38(10,11)12;1-5(2,3)8-4(6)7/h41-42H,14-28H2,1-13H3,(H,43,48)(H,49,50);1-3H3,(H,6,7) |
| InChIKey | MLQOATOYGOJQSA-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 255.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 946.19 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|