C16H14F3N3O2 — CID 167172931
5-methyl-8-prop-2-enoyl-3-(trifluoromethyl)-9,10-dihydro-7H-pyrido[3,4-c][1,5]naphthyridin-6-one (PubChem CID 167172931) has the molecular formula C16H14F3N3O2 and a molecular weight of 337.30 g/mol. Its IUPAC name is 5-methyl-8-prop-2-enoyl-3-(trifluoromethyl)-9,10-dihydro-7H-pyrido[3,4-c][1,5]naphthyridin-6-one.
| Compound Name | 5-methyl-8-prop-2-enoyl-3-(trifluoromethyl)-9,10-dihydro-7H-pyrido[3,4-c][1,5]naphthyridin-6-one |
|---|---|
| PubChem CID | 167172931 |
| Molecular Formula | C16H14F3N3O2 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 5-methyl-8-prop-2-enoyl-3-(trifluoromethyl)-9,10-dihydro-7H-pyrido[3,4-c][1,5]naphthyridin-6-one |
| SMILES | C=CC(=O)N1CCc2c(c(=O)n(C)c3cc(C(F)(F)F)cnc23)C1 |
| InChI | InChI=1S/C16H14F3N3O2/c1-3-13(23)22-5-4-10-11(8-22)15(24)21(2)12-6-9(16(17,18)19)7-20-14(10)12/h3,6-7H,1,4-5,8H2,2H3 |
| InChIKey | FLYSPNGXLQHRSI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|