C19H23F3N4O4 — CID 167172963
8-[3-[[(2R)-azetidin-2-yl]methoxy]-2-hydroxypropanoyl]-3-(trifluoromethyl)-6a,7,9,10-tetrahydro-6H-pyrazino[1,2-a][1,8]naphthyridin-5-one (PubChem CID 167172963) has the molecular formula C19H23F3N4O4 and a molecular weight of 428.41 g/mol. Its IUPAC name is 8-[3-[[(2R)-azetidin-2-yl]methoxy]-2-hydroxypropanoyl]-3-(trifluoromethyl)-6a,7,9,10-tetrahydro-6H-pyrazino[1,2-a][1,8]naphthyridin-5-one.
| Compound Name | 8-[3-[[(2R)-azetidin-2-yl]methoxy]-2-hydroxypropanoyl]-3-(trifluoromethyl)-6a,7,9,10-tetrahydro-6H-pyrazino[1,2-a][1,8]naphthyridin-5-one |
|---|---|
| PubChem CID | 167172963 |
| Molecular Formula | C19H23F3N4O4 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 8-[3-[[(2R)-azetidin-2-yl]methoxy]-2-hydroxypropanoyl]-3-(trifluoromethyl)-6a,7,9,10-tetrahydro-6H-pyrazino[1,2-a][1,8]naphthyridin-5-one |
| SMILES | O=C1CC2CN(C(=O)C(O)COC[C@H]3CCN3)CCN2c2ncc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C19H23F3N4O4/c20-19(21,22)11-5-14-15(27)6-13-8-25(3-4-26(13)17(14)24-7-11)18(29)16(28)10-30-9-12-1-2-23-12/h5,7,12-13,16,23,28H,1-4,6,8-10H2/t12-,13?,16?/m1/s1 |
| InChIKey | VFSYQQQDUYHMBJ-VEAWUBTESA-N |
| XLogP | 0.44 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |