C17H22F3N5O3 — CID 167172943
3-[[(2S)-azetidin-2-yl]methoxy]-2-hydroxy-1-[5-(trifluoromethyl)-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-11-yl]propan-1-one (PubChem CID 167172943) has the molecular formula C17H22F3N5O3 and a molecular weight of 401.39 g/mol. Its IUPAC name is 3-[[(2S)-azetidin-2-yl]methoxy]-2-hydroxy-1-[5-(trifluoromethyl)-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-11-yl]propan-1-one.
| Compound Name | 3-[[(2S)-azetidin-2-yl]methoxy]-2-hydroxy-1-[5-(trifluoromethyl)-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-11-yl]propan-1-one |
|---|---|
| PubChem CID | 167172943 |
| Molecular Formula | C17H22F3N5O3 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 3-[[(2S)-azetidin-2-yl]methoxy]-2-hydroxy-1-[5-(trifluoromethyl)-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-11-yl]propan-1-one |
| SMILES | O=C(C(O)COC[C@@H]1CCN1)N1CCN2c3ncc(C(F)(F)F)cc3NC2C1 |
| InChI | InChI=1S/C17H22F3N5O3/c18-17(19,20)10-5-12-15(22-6-10)25-4-3-24(7-14(25)23-12)16(27)13(26)9-28-8-11-1-2-21-11/h5-6,11,13-14,21,23,26H,1-4,7-9H2/t11-,13?,14?/m0/s1 |
| InChIKey | VSMLPVDQYDZYQV-XGNXJENSSA-N |
| XLogP | 0.24 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |